For research use only. Not for therapeutic Use.
DL-3-Phenylalanine-d8(Cat No.:S000743) is a deuterated form of DL-3-Phenylalanine, where eight hydrogen atoms are replaced with deuterium, improving its molecular stability. This makes it highly useful as an internal standard for analytical methods such as mass spectrometry and NMR spectroscopy. DL-3-Phenylalanine is a racemic mixture of L- and D- forms of the amino acid phenylalanine, which plays a key role in protein synthesis.
CAS Number | 29909-00-0 |
Molecular Formula | C9H3D8NO2 |
Purity | ≥95% |
IUPAC Name | 2-amino-2,3,3-trideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)propanoic acid |
InChI | InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/i1D,2D,3D,4D,5D,6D2,8D |
InChIKey | COLNVLDHVKWLRT-INHGFZCOSA-N |
SMILES | C1=CC=C(C=C1)CC(C(=O)O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |