For research use only. Not for therapeutic Use.
DL-3-Phenyllactic acid(Cat No.:I019907) is a potent antimicrobial compound with broad-spectrum activity. It exhibits effectiveness against a wide range of microorganisms, including bacteria, fungi, and yeasts. Its antimicrobial properties arise from its ability to disrupt the cellular membranes and metabolic pathways of these pathogens. DL-3-Phenyllactic acid holds promise as a natural alternative to conventional antimicrobial agents and has potential applications in various industries, including food preservation, pharmaceuticals, and cosmetics, due to its broad-spectrum activity and natural origin.
CAS Number | 828-01-3 |
Molecular Formula | C₉H₁₀O₃ |
Purity | ≥95% |
Target | Anti-infection |
Storage | 2-8°C |
IUPAC Name | 2-hydroxy-3-phenylpropanoic acid |
InChI | InChI=1S/C9H10O3/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8,10H,6H2,(H,11,12) |
InChIKey | VOXXWSYKYCBWHO-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)CC(C(=O)O)O |