For research use only. Not for therapeutic Use.
DL-Alanine-13C-1(Cat No.:S000703) is a labeled form of DL-alanine, where the first carbon atom is enriched with carbon-13, enhancing its detectability in analytical methods such as NMR spectroscopy and mass spectrometry. This isotopic labeling is particularly useful for studying the metabolic pathways involving alanine, a non-essential amino acid important in glucose metabolism and protein synthesis. DL-Alanine is a racemic mixture of L- and D-alanine. The carbon-13 labeling at the first position allows researchers to trace and analyze alanine’s role and transformations in biochemical processes, providing insights into its metabolic functions in various systems.
CAS Number | 102029-81-2 |
Molecular Formula | C213CH7NO2 |
Purity | ≥95% |
Target | Endogenous Metabolite |
IUPAC Name | 2-amino(113C)propanoic acid |
InChI | InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/i3+1 |
InChIKey | QNAYBMKLOCPYGJ-LBPDFUHNSA-N |
SMILES | CC(C(=O)O)N |