DL-Alanine-13C-3（Cat No.:S000647） is a stable isotope-labeled form of the amino acid alanine, where the third carbon atom is enriched with carbon-13 (13C). This labeling variant includes both D- and L-isomers of alanine. The use of 13C-3 labeling is particularly valuable in scientific studies that utilize mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy to track and analyze metabolic pathways. By studying this labeled compound, researchers can observe the metabolism of alanine in various biological processes, including its role in glucose production, energy metabolism, and protein synthesis, providing deeper insights into cellular functions.
| Catalog Number | S000647 |
| CAS Number | 131157-42-1 |
| Molecular Formula | C213CH7NO2 |
| Purity | 95% |
| IUPAC Name | 2-amino(313C)propanoic acid |
| InChI | InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/i1+1 |
| InChIKey | QNAYBMKLOCPYGJ-OUBTZVSYSA-N |
| SMILES | CC(C(=O)O)N |
