For research use only. Not for therapeutic Use.
DL-Alanine-d3(Cat No.:S000671) is a deuterated form of DL-alanine, where three hydrogen atoms are replaced with deuterium, enhancing its molecular stability. This isotopic modification makes it highly useful as an internal standard for analytical methods such as mass spectrometry and NMR spectroscopy. DL-alanine is a racemic mixture of the D and L isomers of alanine, an amino acid involved in glucose metabolism and protein synthesis. The introduction of deuterium in DL-Alanine-d3 enables more precise pharmacokinetic and metabolic research, helping to better understand its behavior and interactions within biological systems.
Catalog Number | S000671 |
CAS Number | 53795-94-1 |
Molecular Formula | C3H4D3NO2 |
Purity | ≥95% |
Target | Endogenous Metabolite |
IUPAC Name | 2-amino-3,3,3-trideuteriopropanoic acid |
InChI | InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/i1D3 |
InChIKey | QNAYBMKLOCPYGJ-FIBGUPNXSA-N |
SMILES | CC(C(=O)O)N |