For research use only. Not for therapeutic Use.
DL-Carnitine hydrochloride (Cat No.:A000662) is a salt form of the naturally occurring compound carnitine. Carnitine is an amino acid derivative that plays a crucial role in the transport of fatty acids into the mitochondria, where they are metabolized to produce energy. DL-Carnitine hydrochloride is commonly used as a dietary supplement to support fat metabolism, energy production, and overall physical performance. It is also used in the treatment of certain medical conditions, including carnitine deficiency and some cardiovascular disorders.
CAS Number | 461-05-2 |
Synonyms | NA |
Molecular Formula | C7H15NO3.HCl |
Purity | ≥95% |
Target | NF-κB |
Storage | RT |
IUPAC Name | (3-carboxy-2-hydroxypropyl)-trimethylazanium;chloride |
InChI | InChI=1S/C7H15NO3.ClH/c1-8(2,3)5-6(9)4-7(10)11;/h6,9H,4-5H2,1-3H3;1H |
InChIKey | JXXCENBLGFBQJM-UHFFFAOYSA-N |
SMILES | C[N+](C)(C)CC(CC(=O)O)O.[Cl-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |