For research use only. Not for therapeutic Use.
D,L-Cystathionine（Cat No.:R002676）is a racemic mixture of the amino acid derivative cystathionine, crucial in biochemical research and metabolic studies. This compound plays a significant role in the transsulfuration pathway, where it acts as an intermediate in the conversion of homocysteine to cysteine. D,L-Cystathionine is commonly used in studies related to amino acid metabolism, enzyme activity, and the investigation of metabolic disorders such as homocystinuria. The 90% purity ensures its suitability for various research applications, providing reliable results in experimental settings.
| Catalog Number | R002676 |
| CAS Number | 535-34-2 |
| Synonyms | S-(2-Amino-2-carboxyethyl)homocysteine; DL-Allocystathionine; NSC 118379 |
| Molecular Formula | C7H14N2O4S |
| Purity | ≥95% |
| IUPAC Name | 2-amino-4-(2-amino-2-carboxyethyl)sulfanylbutanoic acid |
| InChI | InChI=1S/C7H14N2O4S/c8-4(6(10)11)1-2-14-3-5(9)7(12)13/h4-5H,1-3,8-9H2,(H,10,11)(H,12,13) |
| InChIKey | ILRYLPWNYFXEMH-UHFFFAOYSA-N |
| SMILES | C(CSCC(C(=O)O)N)C(C(=O)O)N |
