For research use only. Not for therapeutic Use.
DL-Ethionine sulfoxide(Cat No.:M085393) is a derivative of the amino acid methionine, characterized by the addition of a sulfoxide group to its molecular structure. This modification imparts unique chemical properties to the molecule, such as increased polarity and reactivity compared to its parent compound. DL-Ethionine sulfoxide is used in biochemical research, often studied for its effects on metabolic processes and as a methylation inhibitor in cells. This compound serves as a tool in molecular biology and biochemistry to explore the regulation and disruption of methylation pathways, critical for understanding gene expression and enzyme activity.
CAS Number | 4378-21-6 |
Synonyms | DL-ETHIONINE SULFOXIDE |
Molecular Formula | C6H13NO3S |
Purity | ≥95% |
Storage | -80°C |
Related CAS | 15785-31-6 |
IUPAC Name | 2-amino-4-ethylsulfinylbutanoic acid |
InChI | InChI=1S/C6H13NO3S/c1-2-11(10)4-3-5(7)6(8)9/h5H,2-4,7H2,1H3,(H,8,9) |
InChIKey | ZEZVOWDXHLTCLO-UHFFFAOYSA-N |
SMILES | CCS(=O)CCC(C(=O)O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |