For research use only. Not for therapeutic Use.
DL-Glutamine(Cat No.:I000058)is a non-essential amino acid that is commonly used as a supplement to support muscle growth, immune function, and gut health. It plays a crucial role in protein synthesis and is involved in various metabolic processes in the body. DL-Glutamine is also used in cell culture media to support the growth of various cell types and in the production of antibiotics and other pharmaceuticals.
CAS Number | 6899-04-3 |
Molecular Formula | C5H10N2O3 |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Solubility | DMSO: < 1.7 mg/mL |
Storage | Keep in dark place,Inert atmosphere,Room temperature |
IUPAC Name | 2,5-diamino-5-oxopentanoic acid |
InChI | InChI=1S/C5H10N2O3/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H2,7,8)(H,9,10) |
InChIKey | ZDXPYRJPNDTMRX-UHFFFAOYSA-N |
SMILES | C(CC(=O)N)C(C(=O)O)N |