For research use only. Not for therapeutic Use.
DL-Homocysteine-d4(Cat No.:S000590) is a specialized form of homocysteine, an amino acid involved in methionine metabolism and a marker for cardiovascular disease risk. The “d4” designation indicates that four hydrogen atoms in the homocysteine molecule are replaced with deuterium, a stable isotope of hydrogen. This isotopic labeling enables precise tracking of homocysteine metabolism and its role in various biochemical pathways using techniques like mass spectrometry. DL-Homocysteine-d4 is valuable in metabolic studies, helping researchers understand the pathophysiology of conditions related to homocysteine metabolism, such as cardiovascular disease, and facilitating the development of diagnostic and therapeutic strategies.
CAS Number | 416845-90-4 |
Molecular Formula | C4H5D4NO2S |
Purity | ≥95% |
Target | Endogenous Metabolite |
IUPAC Name | 2-amino-3,3,4,4-tetradeuterio-4-sulfanylbutanoic acid |
InChI | InChI=1S/C4H9NO2S/c5-3(1-2-8)4(6)7/h3,8H,1-2,5H2,(H,6,7)/i1D2,2D2 |
InChIKey | FFFHZYDWPBMWHY-LNLMKGTHSA-N |
SMILES | C(CS)C(C(=O)O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |