For research use only. Not for therapeutic Use.
DL-Isoserine(Cat No.:R023303)is a non-proteinogenic amino acid used in pharmaceutical research and organic synthesis. It is a racemic mixture of D- and L-isomers, featuring a hydroxyl group on the β-carbon, making it structurally distinct from serine. DL-Isoserine serves as a building block in the synthesis of various peptides and bioactive molecules. Its unique structure allows for the exploration of new chemical reactions and the development of novel therapeutic agents. This compound is particularly valuable in studies focused on enzyme inhibition and the design of pharmaceuticals with specific stereochemistry.
CAS Number | 565-71-9 |
Synonyms | (±)-Isoserine; 2-Hydroxy-β-alanine; 3-Amino-2-hydroxypropanoic Acid; 3-Amino-2-hydroxypropionic Acid; 3-Aminolactic Acid; |
Molecular Formula | C3H7NO3 |
Purity | ≥95% |
IUPAC Name | 3-amino-2-hydroxypropanoic acid |
InChI | InChI=1S/C3H7NO3/c4-1-2(5)3(6)7/h2,5H,1,4H2,(H,6,7) |
InChIKey | BMYNFMYTOJXKLE-UHFFFAOYSA-N |
SMILES | C(C(C(=O)O)O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |