For research use only. Not for therapeutic Use.
DL-Pipecolic Acid-d9 is a deuterated analog of DL-Pipecolic Acid, essential for advanced pharmaceutical and biochemical research. This isotopically labeled compound aids in the precise study of metabolic pathways, amino acid metabolism, and neurological functions. Its stable isotope labeling ensures accurate mass spectrometry and NMR analysis, providing reliable and reproducible data. Ideal for research on metabolic disorders, neurological diseases, and drug development, DL-Pipecolic Acid-d9 enhances the understanding of its biological roles and potential applications, making it indispensable for innovative scientific investigations.
Catalog Number | R053991 |
CAS Number | 790612-94-1 |
Synonyms | 2-Piperidine-2,3,3,4,4,5,5,6,6-d9-carboxylic Acid; 2-Piperidinecarboxylic Acid-d9; Pipecolic Acid-d9; (RS)-2-Piperidinecarboxylic Acid-d9; (±)-2-Piperidinecarboxylic Acid-d9; (±)-Pipecolic Acid-d9; 2-Carboxypiperidine-d9; 2-Pipecolinic Acid-d9; 2-Pip |
Molecular Formula | C6H11NO2 |
Purity | ≥95% |
Storage | 3 years -20 ℃ |
IUPAC Name | 2,3,3,4,4,5,5,6,6-nonadeuteriopiperidine-2-carboxylic acid |
InChI | InChI=1S/C6H11NO2/c8-6(9)5-3-1-2-4-7-5/h5,7H,1-4H2,(H,8,9)/i1D2,2D2,3D2,4D2,5D |
InChIKey | HXEACLLIILLPRG-UHUJFCCWSA-N |
SMILES | C1CCNC(C1)C(=O)O |