For research use only. Not for therapeutic Use.
DL-Pyroglutamic acid-d5 is a stable isotope-labeled derivative of pyroglutamic acid, where five hydrogen atoms are replaced with deuterium. This compound is significant in metabolic studies and tracer experiments, allowing researchers to track metabolic pathways and the dynamics of amino acid utilization in biological systems. Pyroglutamic acid itself plays a role in protein metabolism and is involved in neurotransmitter synthesis. The deuterated form enhances sensitivity in analytical techniques, such as mass spectrometry, facilitating precise quantification in pharmacokinetic and biochemical research.
CAS Number | 352431-30-2 |
Molecular Formula | C5H2D5NO3 |
Purity | ≥95% |
Target | Neuronal Signaling |
InChI | 1S/C5H7NO3/c7-4-2-1-3(6-4)5(8)9/h3H,1-2H2,(H,6,7)(H,8,9)/i1D2,2D2,3D |
InChIKey | ODHCTXKNWHHXJC-UXXIZXEISA-N |
SMILES | [2H]C1(C(=O)NC(C1([2H])[2H])([2H])C(=O)O)[2H] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |