For research use only. Not for therapeutic Use.
DL-Serine-2,3,3-d3(Cat No.:S000716) is a deuterated form of DL-serine, where three hydrogen atoms at the beta carbon are replaced with deuterium, enhancing its molecular stability. This isotopic modification makes it highly suitable as an internal standard for analytical techniques like mass spectrometry and NMR spectroscopy. DL-serine is a racemic mixture of the amino acid serine, which plays a crucial role in protein synthesis, as well as in metabolic and neurological functions. The deuterium labeling in DL-Serine-2,3,3-d3 allows for more accurate and detailed studies of serine metabolism and its interactions within biological systems.
CAS Number | 70094-78-9 |
Molecular Formula | C3H4D3NO3 |
Purity | ≥95% |
Target | TMV |
IUPAC Name | 2-amino-2,3,3-trideuterio-3-hydroxypropanoic acid |
InChI | InChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7)/i1D2,2D |
InChIKey | MTCFGRXMJLQNBG-FUDHJZNOSA-N |
SMILES | C(C(C(=O)O)N)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |