For research use only. Not for therapeutic Use.
D, L-threo-β-hydroxy aspartic acid(Cat No.:R001570) is a stereoisomer of the amino acid aspartic acid, characterized by a β-hydroxy group attached to the α-carbon. This compound is found in nature and is a key intermediate in the biosynthesis of several important molecules, including amino sugars and certain antibiotics. Its stereochemistry plays a crucial role in its biological activity and function. D, L-threo-β-hydroxy aspartic acid has been studied for its potential therapeutic applications, particularly in the development of pharmaceuticals targeting specific enzymes or receptors involved in various metabolic pathways or diseases.
CAS Number | 4294-45-5 |
Synonyms | DL-tHya, threo-2-Amino-3-hydroxysuccinic Acid |
Molecular Formula | C₄H₇NO₅ |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | (2S,3S)-2-amino-3-hydroxybutanedioic acid |
InChI | InChI=1S/C4H7NO5/c5-1(3(7)8)2(6)4(9)10/h1-2,6H,5H2,(H,7,8)(H,9,10)/t1-,2-/m0/s1 |
InChIKey | YYLQUHNPNCGKJQ-LWMBPPNESA-N |
SMILES | C(C(C(=O)O)O)(C(=O)O)N |