For research use only. Not for therapeutic Use.
DL-Tryptophan-d8（Cat No.:I043748）is a stable isotope-labeled form of the amino acid tryptophan, where eight hydrogen atoms are replaced with deuterium, a stable hydrogen isotope. This labeled compound is widely used in metabolic research, particularly in studies of protein synthesis, metabolic flux, and enzyme reactions. The deuterium labeling allows for precise tracking of tryptophan’s incorporation and metabolism in biological systems. DL-Tryptophan-d8 is ideal for isotope dilution analysis, proteomics, and tracer studies, making it a valuable tool for investigating the biochemical pathways of tryptophan and its related metabolites.
| CAS Number | 1233395-85-1 |
| Synonyms | 2-amino-2,3,3-trideuterio-3-(2,4,5,6,7-pentadeuterio-1H-indol-3-yl)propanoic acid |
| Molecular Formula | C11H4D8N2O2 |
| Purity | ≥95% |
| IUPAC Name | 2-amino-2,3,3-trideuterio-3-(2,4,5,6,7-pentadeuterio-1H-indol-3-yl)propanoic acid |
| InChI | InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/i1D,2D,3D,4D,5D2,6D,9D |
| InChIKey | QIVBCDIJIAJPQS-JLAWCNLZSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(N2)[2H])C([2H])([2H])C([2H])(C(=O)O)N)[2H])[2H] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
