For research use only. Not for therapeutic Use.
Tryptophan is an amino acid precursor of serotonin and melatonin. DL-Tryptophan octyl ester is a tryptophan derivative with an octyl ester protected COOH group. This addition creates a stable, cell-permeable molecule capable of generating free tryptophan upon hydrolysis of the ester bond.
| Catalog Number | R065602 |
| CAS Number | 6278-90-6 |
| Synonyms | NSC 34501 |
| Molecular Formula | C19H29ClN2O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | octyl 2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride |
| InChI | InChI=1S/C19H28N2O2.ClH/c1-2-3-4-5-6-9-12-23-19(22)17(20)13-15-14-21-18-11-8-7-10-16(15)18;/h7-8,10-11,14,17,21H,2-6,9,12-13,20H2,1H3;1H |
| InChIKey | IASIBURGMIVLIA-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOC(=O)C(CC1=CNC2=CC=CC=C21)N.Cl |
| Reference | 1.Nakamura, H. and Pisano, J.J. Sensitive and specific detection of tryptophan, tryptamine and N-terminal tryptophan peptides on thin-layer plates using a unique fluorogenic reaction with fluorescamine. Journal of Chromatography 152, 153-165 (1978). |
