DL-Tyrosine-13C9,15N(Cat No.:S000732) is a labeled form of DL-Tyrosine where all nine carbon atoms are enriched with carbon-13 and the nitrogen atom is enriched with nitrogen-15, significantly enhancing its detectability in analytical studies like NMR spectroscopy and mass spectrometry. This isotopic labeling is crucial for detailed studies of protein synthesis and enzyme interactions involving tyrosine. DL-Tyrosine is a non-essential amino acid used in protein biosynthesis. The dual labeling allows for precise tracking of tyrosine’s incorporation into proteins and its metabolism, providing insights into biological pathways and molecular mechanisms.
Catalog Number | S000732 |
CAS Number | 202407-26-9 |
Molecular Formula | 13C9H1115NO3 |
Purity | 95% |
IUPAC Name | (2S)-2-(15N)azanyl-3-(4-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)(1,2,3-13C3)propanoic acid |
InChI | InChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1/i1+1,2+1,3+1,4+1,5+1,6+1,7+1,8+1,9+1,10+1 |
InChIKey | OUYCCCASQSFEME-CMLFETTRSA-N |
SMILES | C1=CC(=CC=C1CC(C(=O)O)N)O |