For research use only. Not for therapeutic Use.
DL-Valine-d8(Cat No.:S000655) is a deuterated form of DL-valine, where eight hydrogen atoms are replaced with deuterium, enhancing its molecular stability. This modification makes it particularly useful as an internal standard for analytical methods such as mass spectrometry and NMR spectroscopy. DL-valine is a racemic mixture of the essential amino acid valine, involved in protein synthesis and muscle metabolism. The introduction of deuterium in DL-Valine-d8 allows for more precise pharmacokinetic and metabolic studies, facilitating detailed research into its absorption, distribution, metabolism, and excretion, as well as its role in biological systems.
CAS Number | 203784-63-8 |
Molecular Formula | C5H3D8NO2 |
Purity | ≥95% |
IUPAC Name | 2-amino-2,3,4,4,4-pentadeuterio-3-(trideuteriomethyl)butanoic acid |
InChI | InChI=1S/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8)/i1D3,2D3,3D,4D |
InChIKey | KZSNJWFQEVHDMF-PIODKIDGSA-N |
SMILES | CC(C)C(C(=O)O)N |