For research use only. Not for therapeutic Use.
DLin-KC2-DMA(CAT: I019469) is a cationic lipid widely used in the formulation of lipid nanoparticles (LNPs) for delivering nucleic acids, such as siRNA and mRNA, in pharmaceutical and biomedical research. Its unique structure enables effective encapsulation and delivery of nucleic acids into target cells, enhancing transfection efficiency and stability. DLin-KC2-DMA is particularly valuable in developing RNA-based therapeutics and vaccines, offering optimized delivery systems for in vivo applications. Its role in enhancing endosomal escape and protecting payloads from degradation makes it a critical component in advancing gene therapy and precision medicine.
| CAS Number | 1190197-97-7 |
| Molecular Formula | C₄₃H₇₉NO₂ |
| Purity | ≥95% |
| Target | Liposome |
| IUPAC Name | 2-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]-N,N-dimethylethanamine |
| InChI | InChI=1S/C43H79NO2/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-38-43(45-41-42(46-43)37-40-44(3)4)39-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,42H,5-12,17-18,23-41H2,1-4H3/b15-13-,16-14-,21-19-,22-20- |
| InChIKey | LRFJOIPOPUJUMI-KWXKLSQISA-N |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC1(OC(CO1)CCN(C)C)CCCCCCCC/C=C\C/C=C\CCCCC |
