For research use only. Not for therapeutic Use.
DLin-M-K-DMA(Cat No.:I041061)is a lipid-like molecule used in the field of nanomedicine, specifically in the design of lipid nanoparticles for drug delivery systems. It is a derivative of the polycationic lipid class and is often employed in the formulation of mRNA or gene therapy delivery vehicles. The molecule consists of a lipid tail (DLin), a lysine-based linker (M-K), and a dimethylamine group (DMA) that enhances its ability to interact with and stabilize nucleic acids. DLin-M-K-DMA is crucial for efficient gene delivery, improving cellular uptake and endosomal escape, thus enhancing therapeutic efficacy.
CAS Number | 1221271-55-1 |
Synonyms | [(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl] 3-(dimethylamino)propanoate |
Molecular Formula | C42H77NO2 |
Purity | ≥95% |
IUPAC Name | [(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl] 3-(dimethylamino)propanoate |
InChI | InChI=1S/C42H77NO2/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-41(45-42(44)39-40-43(3)4)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,41H,5-12,17-18,23-40H2,1-4H3/b15-13-,16-14-,21-19-,22-20- |
InChIKey | BAHNSDYHBUZBBI-KWXKLSQISA-N |
SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(OC(=O)CCN(C)C)CCCCCCCC/C=C\C/C=C\CCCCC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |