For research use only. Not for therapeutic Use.
DMABC (Dimethylaminobenzylchloride) (Cat No.: I012676) is an organic compound used primarily in chemical synthesis and as an intermediate in the production of various pharmaceuticals and chemicals. It contains a benzyl group attached to a dimethylamino group, which makes it an important reagent for introducing specific functionalities into molecules. DMABC is also used in the synthesis of surfactants, agrochemicals, and other bioactive compounds. Its ability to modify molecular structures makes it valuable in drug discovery and the development of specialized chemical products.
CAS Number | 178618-43-4 |
Synonyms | 3-(Dimethylamino)butyl dimethylcarbamate; N,N-Dimethyl-carbamic acid 3-(dimethylamino)butyl ester |
Molecular Formula | C9H20N2O2 |
Purity | ≥95% |
IUPAC Name | 3-(dimethylamino)butyl N,N-dimethylcarbamate |
InChI | InChI=1S/C9H20N2O2/c1-8(10(2)3)6-7-13-9(12)11(4)5/h8H,6-7H2,1-5H3 |
InChIKey | VVGQXMCHKFOTKZ-UHFFFAOYSA-N |
SMILES | CC(CCOC(=O)N(C)C)N(C)C |