For research use only. Not for therapeutic Use.
N,N-Dimethylhexylamine (DMHCA)(CAT: I012675) is a versatile chemical compound widely used in organic synthesis and pharmaceutical research. As an aliphatic amine, DMHCA serves as a key intermediate in the production of various pharmaceutical agents, agrochemicals, and specialty chemicals. Its structural properties, featuring a six-carbon alkyl chain and two methyl groups attached to the nitrogen atom, make it an ideal building block for creating complex molecules. DMHCA is valued for its stability and reactivity, allowing for precise modifications in chemical reactions, making it a crucial component in developing new drugs and chemical products.
CAS Number | 79066-03-8 |
Synonyms | (4R)-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N,N-dimethylpentanamide |
Molecular Formula | C26H43NO2 |
Purity | ≥95% |
IUPAC Name | (4R)-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N,N-dimethylpentanamide |
InChI | InChI=1S/C26H43NO2/c1-17(6-11-24(29)27(4)5)21-9-10-22-20-8-7-18-16-19(28)12-14-25(18,2)23(20)13-15-26(21,22)3/h7,17,19-23,28H,6,8-16H2,1-5H3/t17-,19+,20+,21-,22+,23+,25+,26-/m1/s1 |
InChIKey | NDGUBXOBXSPVHJ-LXVLQKCJSA-N |
SMILES | C[C@H](CCC(=O)N(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O)C)C |