For research use only. Not for therapeutic Use.
DMNB (Cat No.:I010506) is a yellow crystalline solid utilized as a versatile chemical reagent. Its primary applications include serving as a reducing agent in chemical reactions and synthesis processes. DMNB’s ability to undergo reduction reactions makes it valuable in redox analysis and related studies. Additionally, it possesses pH indicator properties, making it useful in applications where color changes are desired to indicate changes in pH levels. Overall, DMNB is a versatile compound with multiple uses in various chemical and analytical contexts.
| Catalog Number | I010506 |
| CAS Number | 20357-25-9 |
| Synonyms | 4,5-Dimethoxy-2-nitrobenzaldehyde |
| Molecular Formula | C9H9NO5 |
| Purity | ≥95% |
| Target | DNA-PK |
| Solubility | Soluble to 25 mM in ethanol with gentle warming and to 100 mM in DMSO |
| Storage | Room Temperature |
| IUPAC Name | 4,5-dimethoxy-2-nitrobenzaldehyde |
| InChI | InChI=1S/C9H9NO5/c1-14-8-3-6(5-11)7(10(12)13)4-9(8)15-2/h3-5H,1-2H3 |
| InChIKey | YWSPWKXREVSQCA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C=O)[N+](=O)[O-])OC |
