For research use only. Not for therapeutic Use.
DMNQ is a 1,4-naphthoquinone that acts as a redox-cycling agent, typically increasing intracellular superoxide and hydrogen peroxide formation. The amount of oxidative stress is proportional to the amount of DMNQ applied and can alter diverse cellular parameters, including signal transduction, mitochondrial function, and gene expression.
| Catalog Number | R066582 |
| CAS Number | 6956-96-3 |
| Synonyms | NSC 69355 |
| Molecular Formula | C12H10O4 |
| Purity | ≥95% |
| Target | NF-κB |
| Storage | -20°C |
| IUPAC Name | 2,3-dimethoxynaphthalene-1,4-dione |
| InChI | InChI=1S/C12H10O4/c1-15-11-9(13)7-5-3-4-6-8(7)10(14)12(11)16-2/h3-6H,1-2H3 |
| InChIKey | ZEGDFCCYTFPECB-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=O)C2=CC=CC=C2C1=O)OC |
| Reference | 1.Kaas, G.E.N.,Duddy, S.K. and Orrenius, S. Activation of hepatocyte protein kinase C by redox-cycling quinones. Biochemistry Journal 260(2), 499-507 (1989). |
