For research use only. Not for therapeutic Use.
DMP 754(Cat No.:M128494) is a potent and selective antagonist of the metabotropic glutamate receptor subtype 5 (mGluR5). This compound has been studied for its potential therapeutic effects in various neurological and psychiatric disorders, including fragile X syndrome, Parkinson’s disease, and addiction. By blocking mGluR5, DMP 754 can modulate glutamatergic neurotransmission, which plays a crucial role in these conditions. Preclinical studies have shown promising results, suggesting that mGluR5 antagonists like DMP 754 could be a potential treatment strategy for these disorders.
CAS Number | 170902-47-3 |
Molecular Formula | C21H29N5O6 |
Purity | ≥95% |
Storage | Store at -20C |
IUPAC Name | methyl (2S)-2-(butoxycarbonylamino)-3-[[2-[(5R)-3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]propanoate |
InChI | InChI=1S/C21H29N5O6/c1-3-4-9-31-21(29)25-17(20(28)30-2)12-24-18(27)11-15-10-16(26-32-15)13-5-7-14(8-6-13)19(22)23/h5-8,15,17H,3-4,9-12H2,1-2H3,(H3,22,23)(H,24,27)(H,25,29)/t15-,17+/m1/s1 |
InChIKey | IRAXRQFCCSHQDX-WBVHZDCISA-N |
SMILES | CCCCOC(=O)NC(CNC(=O)CC1CC(=NO1)C2=CC=C(C=C2)C(=N)N)C(=O)OC |