For research use only. Not for therapeutic Use.
DMXZSDJKAIYXMV-TVIFIVJDSA-N is a unique identifier for a specific chemical compound, often used in databases and research literature. While the structural details may not be readily available, compounds represented by such identifiers typically undergo extensive research to determine their properties, biological activities, and potential applications. These compounds could be relevant in fields such as medicinal chemistry, materials science, or pharmacology. Understanding their characteristics is essential for developing new therapeutic agents or innovative materials in various scientific disciplines.
CAS Number | 869222-68-4 |
Molecular Formula | C14H16F3N3O7 |
Purity | ≥95% |
IUPAC Name | N-[(E)-3-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]prop-2-enyl]-2,2,2-trifluoroacetamide |
InChI | InChI=1S/C14H16F3N3O7/c15-14(16,17)12(25)18-3-1-2-6-4-20(13(26)19-10(6)24)11-9(23)8(22)7(5-21)27-11/h1-2,4,7-9,11,21-23H,3,5H2,(H,18,25)(H,19,24,26)/b2-1+/t7-,8-,9-,11-/m1/s1 |
InChIKey | DMXZSDJKAIYXMV-TVIFIVJDSA-N |
SMILES | C1=C(C(=O)NC(=O)N1C2C(C(C(O2)CO)O)O)C=CCNC(=O)C(F)(F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |