For research use only. Not for therapeutic Use.
DN02（Cat No.:I042836）is a small molecule compound primarily studied for its potential therapeutic applications in cancer treatment. It functions as a selective inhibitor targeting specific kinases involved in cell signaling and proliferation. By blocking these kinases, DN02 can disrupt tumor cell growth and survival, making it a candidate for cancer therapy, particularly in cases resistant to conventional treatments. Researchers also explore its ability to modulate immune responses and enhance anti-tumor immunity. DN02 shows promise in preclinical studies, with ongoing investigations into its effectiveness and safety in clinical trials for various cancers.
| Synonyms | 4-[4-[(3-aminoazetidin-1-yl)methyl]-2,6-dimethoxyphenyl]-7-fluoro-2-methylisoquinolin-1-one |
| Molecular Formula | C22H24FN3O3 |
| Purity | ≥95% |
| IUPAC Name | 4-[4-[(3-aminoazetidin-1-yl)methyl]-2,6-dimethoxyphenyl]-7-fluoro-2-methylisoquinolin-1-one |
| InChI | InChI=1S/C22H24FN3O3/c1-25-12-18(16-5-4-14(23)8-17(16)22(25)27)21-19(28-2)6-13(7-20(21)29-3)9-26-10-15(24)11-26/h4-8,12,15H,9-11,24H2,1-3H3 |
| InChIKey | CFUSHHQUUUZFAG-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=C(C1=O)C=C(C=C2)F)C3=C(C=C(C=C3OC)CN4CC(C4)N)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
