For research use only. Not for therapeutic Use.
DND-189（Cat No.:I043812）is a selective small molecule inhibitor that targets specific enzymes involved in cellular processes such as inflammation and cell survival. It has shown promise in research focused on neurodegenerative diseases and cancer. By modulating key signaling pathways, DND-189 helps in the investigation of disease mechanisms and potential therapeutic interventions. Its application extends to studies on neuroinflammation, cell proliferation, and apoptosis, making it valuable in both preclinical and clinical research. DND-189 holds potential for developing treatments targeting conditions related to inflammation and cellular dysfunction.
| CAS Number | 152584-38-8 |
| Synonyms | 17-(2-morpholin-4-ylethylamino)-3,10-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(20),2,4,6,8,12,14,16,18-nonaen-11-one |
| Molecular Formula | C24H22N4O2 |
| Purity | ≥95% |
| IUPAC Name | 17-(2-morpholin-4-ylethylamino)-3,10-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(20),2,4,6,8,12,14,16,18-nonaen-11-one |
| InChI | InChI=1S/C24H22N4O2/c29-24-18-5-3-4-16-19(25-10-11-27-12-14-30-15-13-27)9-8-17(22(16)18)23-26-20-6-1-2-7-21(20)28(23)24/h1-9,25H,10-15H2 |
| InChIKey | JQDZUSDVVHXANW-UHFFFAOYSA-N |
| SMILES | C1COCCN1CCNC2=C3C=CC=C4C3=C(C=C2)C5=NC6=CC=CC=C6N5C4=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
