For research use only. Not for therapeutic Use.
DO3A(Cat No.:I026412), also known as 1,4,7,10-tetraazacyclododecane-1,4,7-triacetic acid, is a chelator or a complexing agent. It belongs to the class of macrocyclic ligands that can form stable complexes with metal ions. The unique structure of DO3A allows it to coordinate with metal ions, such as gadolinium, manganese, or copper, forming stable and soluble complexes. These complexes find applications in various fields, including medical imaging, where they are used as contrast agents in magnetic resonance imaging (MRI), and in coordination chemistry and bioinorganic chemistry for studying metal-ion interactions and properties.
CAS Number | 217973-03-0 |
Synonyms | DO3A |
Molecular Formula | C14H23N4Na3O6 |
Purity | 98% |
Solubility | Soluble in DMSO |
Appearance | Solid powder |
Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
IUPAC Name | Trisodium 1,4,7,10-tetraazacyclododecane-1,4,7-triacetate |
InChI | InChI=1S/C14H26N4O6.3Na/c19-12(20)9-16-3-1-15-2-4-17(10-13(21)22)6-8-18(7-5-16)11-14(23)24;;;/h15H,1-11H2,(H,19,20)(H,21,22)(H,23,24);;;/q;3*+1/p-3 |
InChIKey | OKHVSTSMWHWVMK-UHFFFAOYSA-K |
SMILES | O=C([O-])CN1CCN(CC([O-])=O)CCN(CC([O-])=O)CCNCC1.[Na+].[Na+].[Na+] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |