For research use only. Not for therapeutic Use.
Docosahexaenoic Acid (DHA)（Cat No.:R000099）is an omega-3 fatty acid crucial for brain and eye health, widely studied for its neuroprotective, anti-inflammatory, and cardiovascular benefits. Found in high concentrations in fish oils and algal sources, DHA is integral to cell membrane structure, particularly in the retina and brain, supporting cognitive function and visual development. Additionally, it plays a role in reducing triglycerides, enhancing heart health, and lowering inflammation markers. DHA supplementation is popular for its potential to improve mental clarity, reduce age-related cognitive decline, and support prenatal development.
| Catalog Number | R000099 |
| CAS Number | 6217-54-5 |
| Synonyms | (all-Z)-4,7,10,13,16,19-Docosahexaenoic Acid; DHA; Cervonic Acid; Doconexent; ?Marinol D 50TG; Ropufa 60; |
| Molecular Formula | C22H32O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoic acid |
| InChI | InChI=1S/C22H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h3-4,6-7,9-10,12-13,15-16,18-19H,2,5,8,11,14,17,20-21H2,1H3,(H,23,24)/b4-3-,7-6-,10-9-,13-12-,16-15-,19-18- |
| InChIKey | MBMBGCFOFBJSGT-KUBAVDMBSA-N |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)O |
