For research use only. Not for therapeutic Use.
Docosanoic acid-d3（Cat No.:I043746）is a stable isotope-labeled form of docosanoic acid, a long-chain fatty acid. The deuterium labeling at the 3-position allows for precise tracking in metabolic and biochemical studies. This compound is commonly used in lipid metabolism research, as it can be incorporated into cellular membranes or lipoproteins, facilitating the study of fatty acid synthesis, transport, and oxidation pathways. Docosanoic acid-d3 is also valuable in stable isotope tracer studies, helping researchers investigate metabolic flux and lipid-related disorders. Its applications span from metabolic profiling to lipidomics and enzymatic analysis.
| CAS Number | 1193721-67-3 |
| Synonyms | 22,22,22-trideuteriodocosanoic acid |
| Molecular Formula | C22H41D3O2 |
| Purity | ≥95% |
| IUPAC Name | 22,22,22-trideuteriodocosanoic acid |
| InChI | InChI=1S/C22H44O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h2-21H2,1H3,(H,23,24)/i1D3 |
| InChIKey | UKMSUNONTOPOIO-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])CCCCCCCCCCCCCCCCCCCCC(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
