For research use only. Not for therapeutic Use.
Docosatrienoic Acid(CAT: R067709) is a type of omega-3 fatty acid recognized for its potential health benefits, particularly in cardiovascular and brain health. As an essential nutrient, it is found in various dietary sources, primarily in certain types of fish and seafood. Omega-3 fatty acids like docosatrienoic acid play a vital role in supporting overall well-being and are the focus of ongoing research aimed at understanding their precise mechanisms and recommending dietary strategies or supplements to optimize their intake for improved health outcomes.
CAS Number | 28845-86-5 |
Synonyms | 13Z,16Z,19Z-docosatrienoic acid |
Molecular Formula | C22H38O2 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | -20°C |
InChI | InChI=1S/C22H38O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h3-4,6-7,9-10H,2,5,8,11-21H2,1H3,(H,23,24)/b4-3-,7-6-,10-9- |
InChIKey | WBBQTNCISCKUMU-PDBXOOCHSA-N |
SMILES | CC/C=CC/C=CC/C=CCCCCCCCCCCCC(=O)O |
Reference | 1.Yagaloff, K.A.,Franco, L.,Simko, B., et al. Essential fatty acids are antagonists of the leukotriene B4 receptor. Prostaglandins, Leukot. Essent. Fatty Acids 52(5), 293-297 (1995). |