For research use only. Not for therapeutic Use.
Docosyl Ferulate (Cat.No:R043447) is a natural compound derived from ferulic acid, a plant-derived antioxidant. It exhibits potential health benefits due to its antioxidant and anti-inflammatory properties. Docosyl Ferulate’s unique structure, combining a docosyl (C22) hydrocarbon chain with ferulic acid, contributes to its bioactivity, making it valuable in nutraceutical and skincare applications.
Catalog Number | R043447 |
CAS Number | 101927-24-6 |
Synonyms | (E)-3-(4-Hydroxy-3-methoxyphenyl)-2-propenoic Acid Docosyl Ester; Docosyl trans-ferulate; E-Ferulic Acid Docosyl Ester |
Molecular Formula | C32H54O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | docosyl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
InChI | InChI=1S/C32H54O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-27-36-32(34)26-24-29-23-25-30(33)31(28-29)35-2/h23-26,28,33H,3-22,27H2,1-2H3 |
InChIKey | USNYNNITUQSEEV-UHFFFAOYSA-N |
SMILES | CCCCCCCCCCCCCCCCCCCCCCOC(=O)C=CC1=CC(=C(C=C1)O)OC |