For research use only. Not for therapeutic Use.
Dodecyl Benzenesulfonic Acid(CAT: I026426) is a widely used anionic surfactant characterized by its strong surface-active properties and sulfonic acid functional group. It is commonly employed in research for studying micelle formation, emulsification, and surface chemistry due to its ability to lower surface tension and interact with hydrophobic molecules. Additionally, its acidic nature makes it suitable for applications in catalysis and as a dispersing agent. Dodecyl Benzenesulfonic Acid is extensively studied in materials science, polymer chemistry, and industrial formulations, providing insights into surfactant behavior and aiding the development of detergents, emulsifiers, and stabilizers.
CAS Number | 68584-22-5 |
Synonyms | Dodecyl benzene sulfonic acid; Dodecyl benzenesulfonate; Dodecylbenzenesulphonic acid; Ddbsa; |
Molecular Formula | C18H30O3S |
Purity | 98% |
Solubility | Soluble in DMSO |
Appearance | Solid powder |
Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
IUPAC Name | 4-dodecan-3-ylbenzenesulfonic acid |
InChI | InChI=1S/C18H30O3S/c1-2-3-4-5-6-7-8-9-10-11-12-17-13-15-18(16-14-17)22(19,20)21/h13-16H,2-12H2,1H3,(H,19,20,21) |
InChIKey | KWXICGTUELOLSQ-UHFFFAOYSA-N |
SMILES | CCCCCCCCCC(CC)C1=CC=C(C=C1)S(=O)(=O)O |