For research use only. Not for therapeutic Use.
Donepezil-d4 hydrochloride(Cat No.:S000327) is a deuterated form of donepezil hydrochloride, where four hydrogen atoms are replaced with deuterium. Donepezil is a cholinesterase inhibitor used primarily to treat cognitive symptoms in Alzheimer’s disease. The incorporation of deuterium enhances the molecule’s stability and facilitates detailed pharmacokinetic and metabolic studies. This allows researchers to accurately track how donepezil is processed in the body, leading to insights into its absorption, distribution, metabolism, and elimination.
CAS Number | 1219798-88-5 |
Molecular Formula | C24H26D4ClNO3 |
Purity | ≥95% |
Target | Cholinesterase (ChE) |
IUPAC Name | 2-[dideuterio-[1-[dideuterio(phenyl)methyl]piperidin-4-yl]methyl]-5,6-dimethoxy-2,3-dihydroinden-1-one;hydrochloride |
InChI | InChI=1S/C24H29NO3.ClH/c1-27-22-14-19-13-20(24(26)21(19)15-23(22)28-2)12-17-8-10-25(11-9-17)16-18-6-4-3-5-7-18;/h3-7,14-15,17,20H,8-13,16H2,1-2H3;1H/i12D2,16D2; |
InChIKey | XWAIAVWHZJNZQQ-XFRCSBOFSA-N |
SMILES | COC1=C(C=C2C(=C1)CC(C2=O)CC3CCN(CC3)CC4=CC=CC=C4)OC.Cl |