Donitriptan(Cat No.:M035350) is a research chemical within the class of triptans, a group of drugs primarily used to treat migraine headaches. Triptans work by stimulating serotonin receptors in the brain, leading to the constriction of blood vessels and the reduction of inflammation and pain associated with migraine attacks. Donitriptan, specifically, is designed to target serotonin (5-HT1) receptors, offering potential as an acute migraine treatment. Though similar to other triptans in mechanism, each triptan has variations in efficacy, side effects, and pharmacokinetic profiles, impacting their suitability for individual patients.
Catalog Number | M035350 |
CAS Number | 170912-52-4 |
Molecular Formula | C23H25N5O2 |
Purity | 95% |
Storage | -20°C |
IUPAC Name | 4-[4-[2-[[3-(2-aminoethyl)-1H-indol-5-yl]oxy]acetyl]piperazin-1-yl]benzonitrile |
InChI | InChI=1S/C23H25N5O2/c24-8-7-18-15-26-22-6-5-20(13-21(18)22)30-16-23(29)28-11-9-27(10-12-28)19-3-1-17(14-25)2-4-19/h1-6,13,15,26H,7-12,16,24H2 |
InChIKey | SOHCKWZVTCTQBG-UHFFFAOYSA-N |
SMILES | C1CN(CCN1C2=CC=C(C=C2)C#N)C(=O)COC3=CC4=C(C=C3)NC=C4CCN |