For research use only. Not for therapeutic Use.
<span style="color:#000000;"><span style="font-size:12px;"><span style="font-family:arial,helvetica,sans-serif;">Dopamine 3-O-Sulfate (CAS 51317-41-0) is a metabolite of Dopamine, that has been shown to have the hypotensive effects in anesthetized rats.</span></span></span>
| Catalog Number | R044060 |
| CAS Number | 51317-41-0 |
| Synonyms | 4-(2-Aminoethyl)-1,2-benzenediol 2-(Hydrogen Sulfate); Dopamine 3-Sulfate; Dopamine Sulfate; |
| Molecular Formula | C8H11NO5S |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| Storage | Room temperature |
| IUPAC Name | [5-(2-aminoethyl)-2-hydroxyphenyl] hydrogen sulfate |
| InChI | InChI=1S/C8H11NO5S/c9-4-3-6-1-2-7(10)8(5-6)14-15(11,12)13/h1-2,5,10H,3-4,9H2,(H,11,12,13) |
| InChIKey | NZKRYJGNYPYXJZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CCN)OS(=O)(=O)O)O |
| Reference | <span style="color:#000000;"><span style="font-size:12px;"><span style="font-family:arial,helvetica,sans-serif;">1.Minami, M., et al. "The hypotensive effects of intracerebroventricularly administered dopamine-3-O-sulfate in anesthetized rats." <i style="font-family: Arial, sans-serif; font-size: 13px;">Biogenic amines</i> 11.6 (1995): 487-504.</span></span></span> |
