For research use only. Not for therapeutic Use.
Dopan is a biochemical.
| Catalog Number | I026447 |
| CAS Number | 520-09-2 |
| Synonyms | Dopan; NSC 44629; NSC-44629; NSC44629 |
| Molecular Formula | C9H13Cl2N3O2 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 2,4(1H,3H)-Pyrimidinedione, 5-(bis(2-chloroethyl)amino)-6-methyl- |
| InChI | InChI=1S/C9H13Cl2N3O2/c1-6-7(8(15)13-9(16)12-6)14(4-2-10)5-3-11/h2-5H2,1H3,(H2,12,13,15,16) |
| InChIKey | SDTHIDMOBRXVOQ-UHFFFAOYSA-N |
| SMILES | O=C1NC(C(N(CCCl)CCCl)=C(C)N1)=O |
