For research use only. Not for therapeutic Use.
DOTAP mesylate (Cat No.:I041479) is a cationic lipid commonly used in gene delivery and transfection studies. It facilitates the formation of liposomes that can encapsulate DNA, RNA, or other genetic material, enabling their efficient delivery into cells. The mesylate salt form enhances stability and solubility of DOTAP, making it suitable for in vitro and in vivo applications. DOTAP mesylate is frequently utilized in the development of mRNA vaccines, drug delivery systems, and as a tool in molecular biology for gene editing, RNA transfection, and cell-based assays.
| Catalog Number | I041479 |
| CAS Number | 252769-92-9 |
| Synonyms | 2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl-trimethylazanium;methanesulfonate |
| Molecular Formula | C43H83NO7S |
| Purity | ≥95% |
| IUPAC Name | 2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl-trimethylazanium;methanesulfonate |
| InChI | InChI=1S/C42H80NO4.CH4O3S/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-41(44)46-39-40(38-43(3,4)5)47-42(45)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2;1-5(2,3)4/h20-23,40H,6-19,24-39H2,1-5H3;1H3,(H,2,3,4)/q+1;/p-1/b22-20-,23-21-; |
| InChIKey | APGRDDRQPNSEQY-LQDDAWAPSA-M |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(C[N+](C)(C)C)OC(=O)CCCCCCC/C=C\CCCCCCCC.CS(=O)(=O)[O-] |
