For research use only. Not for therapeutic Use.
Dotinurad (Cat.No:I006520) is a selective urate transporter 1 (URAT1) inhibitor used in the treatment of hyperuricemia and gout. It works by blocking the reabsorption of uric acid in the kidneys, leading to increased excretion and lower serum uric acid levels. Dotinurad helps prevent gout attacks and reduces the risk of uric acid crystal deposition in joints.
| Catalog Number | I006520 |
| CAS Number | 1285572-51-1 |
| Synonyms | Dotinurad;(3,5-dichloro-4-hydroxyphenyl)(1,1-dioxidobenzo[d]thiazol-3(2H)-yl)methanone |
| Molecular Formula | C14H9Cl2NO4S |
| Purity | ≥95% |
| Target | urate transporter inhibitor |
| Solubility | Soluble in DMSO |
| Storage | 0 - 4°C for short term or -20 °C for long term |
| IUPAC Name | (3,5-dichloro-4-hydroxyphenyl)-(1,1-dioxo-2H-1,3-benzothiazol-3-yl)methanone |
| InChI | InChI=1S/C14H9Cl2NO4S/c15-9-5-8(6-10(16)13(9)18)14(19)17-7-22(20,21)12-4-2-1-3-11(12)17/h1-6,18H,7H2 |
| InChIKey | VOFLAIHEELWYGO-UHFFFAOYSA-N |
| SMILES | C1N(C2=CC=CC=C2S1(=O)=O)C(=O)C3=CC(=C(C(=C3)Cl)O)Cl |
