For research use only. Not for therapeutic Use.
DOWANOL 62B（Cat No.:M121166） is a trade name for ethylene glycol monobutyl ether (EGBE), a clear, colorless liquid with a mild, pleasant odor. It is used primarily as a solvent in various industrial applications, including coatings, paints, inks, and cleaning products. EGBE is valued for its high solvency power, low volatility, and ability to dissolve a wide range of substances. It is also used as a coupling agent in formulations to improve the compatibility of different components.
| Catalog Number | M121166 |
| CAS Number | 10213-77-1 |
| Molecular Formula | C10H22O4 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2-[2-(2-methoxypropoxy)propoxy]propan-1-ol |
| InChI | InChI=1S/C10H22O4/c1-8(5-11)13-7-10(3)14-6-9(2)12-4/h8-11H,5-7H2,1-4H3 |
| InChIKey | WAEVWDZKMBQDEJ-UHFFFAOYSA-N |
| SMILES | CC(CO)OCC(C)OCC(C)OC |
