For research use only. Not for therapeutic Use.
Doxorubicin-SMCC (Cat No.:I006528) is a type of non-cleavable linker used in the synthesis of antibody-drug conjugates (ADCs). ADCs are a class of biotherapeutic agents that combine the specificity of monoclonal antibodies with the cytotoxicity of small-molecule drugs. Dox-SMCC contains a doxorubicin molecule, a potent chemotherapeutic agent, covalently attached to a maleimide group that can be conjugated to a thiol-containing functional group of a monoclonal antibody. The non-cleavable linker allows for sustained release of the cytotoxic drug within the target cell, leading to enhanced efficacy and reduced toxicity compared to traditional chemotherapy.
| Catalog Number | I006528 |
| CAS Number | 400647-59-8 |
| Molecular Formula | C39H42N2O14 |
| Purity | ≥95% |
| Solubility | Soluble in DMSO, not in water |
| Storage | 0 - 4 °C for short term or -20 °C for long term |
| IUPAC Name | 4-[(2,5-dioxopyrrol-1-yl)methyl]-N-[(2S,3S,4S,6R)-3-hydroxy-2-methyl-6-[[(1S,3S)-3,5,12-trihydroxy-3-(2-hydroxyacetyl)-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]oxan-4-yl]cyclohexane-1-carboxamide |
| InChI | InChI=1S/C39H42N2O14/c1-17-33(46)22(40-38(51)19-8-6-18(7-9-19)15-41-26(44)10-11-27(41)45)12-28(54-17)55-24-14-39(52,25(43)16-42)13-21-30(24)37(50)32-31(35(21)48)34(47)20-4-3-5-23(53-2)29(20)36(32)49/h3-5,10-11,17-19,22,24,28,33,42,46,48,50,52H,6-9,12-16H2,1-2H3,(H,40,51)/t17-,18?,19?,22-,24-,28-,33+,39-/m0/s1 |
| InChIKey | OTQOQHVWNBKSGU-SAJDXUNTSA-N |
| SMILES | CC1C(C(CC(O1)OC2CC(CC3=C2C(=C4C(=C3O)C(=O)C5=C(C4=O)C(=CC=C5)OC)O)(C(=O)CO)O)NC(=O)C6CCC(CC6)CN7C(=O)C=CC7=O)O |
| Reference | </br>1. Chen, Q.; Gabathuler, R., Efficient Synthesis of Doxorubicin Melanotransferrin p97 Conjugates Through SMCC Linker. Synth. Commun. 2004, 34, (13), 2407-2414.</br> |
