For research use only. Not for therapeutic Use.
Doxycycline hydrochloride (Cat No.:I000301) is a broad-spectrum antibiotic of the tetracycline class. It exhibits bacteriostatic activity by inhibiting protein synthesis in susceptible bacteria. Doxycycline hydrochloride is effective against a wide range of gram-positive and gram-negative bacteria, as well as certain protozoa. It is commonly used to treat various bacterial infections, including respiratory tract infections, skin infections, urinary tract infections, and sexually transmitted diseases. Additionally, doxycycline hydrochloride has anti-inflammatory properties and is sometimes prescribed for the treatment of acne and certain inflammatory conditions.
| Catalog Number | I000301 |
| CAS Number | 10592-13-9 |
| Synonyms | (4S,4aR,5S,5aR,6R,12aR)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;hydrochloride |
| Molecular Formula | C22H24N2O8.HCl |
| Purity | ≥95% |
| Target | Metabolic Enzyme/Protease |
| Solubility | DMSO:50 mg/mL |
| Storage | Store at -20C |
| IUPAC Name | (4S,4aR,5S,5aR,6R,12aR)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;hydrochloride |
| InChI | InChI=1S/C22H24N2O8.ClH/c1-7-8-5-4-6-9(25)11(8)16(26)12-10(7)17(27)14-15(24(2)3)18(28)13(21(23)31)20(30)22(14,32)19(12)29;/h4-7,10,14-15,17,25-27,30,32H,1-3H3,(H2,23,31);1H/t7-,10+,14+,15-,17-,22-;/m0./s1 |
| InChIKey | PTNZGHXUZDHMIQ-CVHRZJFOSA-N |
| SMILES | C[C@@H]1[C@H]2[C@@H]([C@H]3[C@@H](C(=O)C(=C([C@]3(C(=O)C2=C(C4=C1C=CC=C4O)O)O)O)C(=O)N)N(C)C)O.Cl |
| Reference | <p style=”/line-height:25px/”> |
