For research use only. Not for therapeutic Use.
DP00477(Cat No.:I042315)is a small molecule compound under investigation for its potential therapeutic applications, particularly in the treatment of cancer and other proliferative diseases. It is designed to target specific proteins or enzymes involved in the regulation of cell cycle progression, growth, and survival. By inhibiting these targets, DP00477 aims to slow down or stop the proliferation of tumor cells. Preclinical studies suggest its potential in overcoming treatment resistance and enhancing the efficacy of existing cancer therapies. Ongoing research is focused on evaluating its safety, pharmacokinetics, and effectiveness in clinical trials.
CAS Number | 169120-56-3 |
Synonyms | 3-(2-chloroanilino)-2-cyano-3-sulfanylidene-N-[3-(trifluoromethyl)phenyl]propanamide |
Molecular Formula | C17H11ClF3N3OS |
Purity | ≥95% |
IUPAC Name | 3-(2-chloroanilino)-2-cyano-3-sulfanylidene-N-[3-(trifluoromethyl)phenyl]propanamide |
InChI | InChI=1S/C17H11ClF3N3OS/c18-13-6-1-2-7-14(13)24-16(26)12(9-22)15(25)23-11-5-3-4-10(8-11)17(19,20)21/h1-8,12H,(H,23,25)(H,24,26) |
InChIKey | JBTPUMQIJZGWRT-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)NC(=S)C(C#N)C(=O)NC2=CC=CC(=C2)C(F)(F)F)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |