For research use only. Not for therapeutic Use.
DPQ (Cat No.:R016186) is a potent inhibitor of poly(ADP-ribose) polymerase (PARP), an enzyme involved in DNA repair mechanisms. By inhibiting PARP, DPQ disrupts the repair of single-strand DNA breaks, leading to the accumulation of DNA damage and cell death, particularly in cancer cells. This makes DPQ valuable in cancer research, especially in studies focusing on DNA repair, synthetic lethality, and chemotherapy sensitization. Additionally, DPQ is utilized in exploring the role of PARP in various cellular processes, including cell survival, genomic stability, and inflammation.
| CAS Number | 129075-73-6 |
| Synonyms | 5-(4-piperidin-1-ylbutoxy)-3,4-dihydro-2H-isoquinolin-1-one |
| Molecular Formula | C18H26N2O2 |
| Purity | ≥95% |
| IUPAC Name | 5-(4-piperidin-1-ylbutoxy)-3,4-dihydro-2H-isoquinolin-1-one |
| InChI | InChI=1S/C18H26N2O2/c21-18-16-7-6-8-17(15(16)9-10-19-18)22-14-5-4-13-20-11-2-1-3-12-20/h6-8H,1-5,9-14H2,(H,19,21) |
| InChIKey | RVOUDNBEIXGHJY-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)CCCCOC2=CC=CC3=C2CCNC3=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
