For research use only. Not for therapeutic Use.
DR-4004(Cat No.:I006541)is a novel small molecule compound being explored for its potential therapeutic applications, particularly in the field of oncology. It is designed to inhibit specific cellular pathways involved in cancer cell proliferation and survival. By targeting key proteins or enzymes that contribute to tumor growth, DR-4004 may help slow or prevent cancer progression. The compound has shown promise in preclinical studies, with potential use in treating various types of cancer. Ongoing research is focused on assessing its efficacy, safety, and potential for clinical development as a cancer therapy.
CAS Number | 201608-41-5 |
Synonyms | DR-4004; DR 4004; DR4004.;2a-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1,3,4,5-tetrahydrobenzo[cd]indol-2-one |
Molecular Formula | C26H30N2O |
Purity | ≥95% |
Target | 5-HT7 receptor Antagonist |
Solubility | Soluble in DMSO |
Storage | 0 - 4°C for short term or -20 °C for long term |
IUPAC Name | 2a-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1,3,4,5-tetrahydrobenzo[cd]indol-2-one |
InChI | InChI=1S/C26H30N2O/c29-25-26(16-7-11-22-10-6-12-23(27-25)24(22)26)15-4-5-17-28-18-13-21(14-19-28)20-8-2-1-3-9-20/h1-3,6,8-10,12-13H,4-5,7,11,14-19H2,(H,27,29) |
InChIKey | JBQOYPLKTTXLSQ-UHFFFAOYSA-N |
SMILES | C1CC2=C3C(=CC=C2)NC(=O)C3(C1)CCCCN4CCC(=CC4)C5=CC=CC=C5 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |