For research use only. Not for therapeutic Use.
High affinity and selective 5-HT<sub>7</sub> antagonist (pK<sub>i</sub> = 8.14). Exhibits selectivity for 5-HT<sub>7</sub> over other 5-HT receptors. Inhibits 5-HT-induced cAMP accumulation in HEK-293 cells expressing the 5-HT<sub>7</sub> receptor. Orally bioavailable.
| Catalog Number | I011074 |
| CAS Number | 402942-53-4 |
| Synonyms | 6-Chloro-2a-[4-[4-(4-chlorophenyl)-3,6-dihydro-1(2H)-pyridinyl]butyl]-2a,3,4,5-tetrahydrobenz[cd]indol-2(1H)-one hydrochloride |
| Molecular Formula | C26H29Cl3N2O |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | Soluble to 100 mM in DMSO |
| Storage | Desiccate at RT |
| IUPAC Name | 6-chloro-2a-[4-[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]butyl]-1,3,4,5-tetrahydrobenzo[cd]indol-2-one;hydrochloride |
| InChI | InChI=1S/C26H28Cl2N2O.ClH/c27-20-7-5-18(6-8-20)19-11-16-30(17-12-19)15-2-1-13-26-14-3-4-21-22(28)9-10-23(24(21)26)29-25(26)31;/h5-11H,1-4,12-17H2,(H,29,31);1H |
| InChIKey | QAERYGXKDZHTFR-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC3=C2C(C1)(C(=O)N3)CCCCN4CCC(=CC4)C5=CC=C(C=C5)Cl)Cl.Cl |
