For research use only. Not for therapeutic Use.
DR2313(CAT: I010564) holds significance as a competitive inhibitor targeting poly(ADP-ribose) polymerase (PARP). By competitively binding to the active site of PARP enzymes, DR2313 interferes with the enzymatic activity responsible for poly(ADP-ribose) synthesis. This inhibition holds potential implications for modulating DNA repair processes and cellular responses to DNA damage.
| Catalog Number | I010564 |
| CAS Number | 284028-90-6 |
| Synonyms | 1,5,7,8-Tetrahydro-2-methyl-4H-thiopyrano[4,3-d]pyrimidin-4-one |
| Molecular Formula | C8H10N2OS |
| Purity | ≥95% |
| Target | Epigenetics |
| Solubility | Soluble to 40 mM in water |
| Storage | Store at +4C |
| IUPAC Name | 2-methyl-1,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidin-4-one |
| InChI | InChI=1S/C8H10N2OS/c1-5-9-7-2-3-12-4-6(7)8(11)10-5/h2-4H2,1H3,(H,9,10,11) |
| InChIKey | HRYKZAKEAVZGJD-UHFFFAOYSA-N |
| SMILES | CC1=NC(=O)C2=C(N1)CCSC2 |
