For research use only. Not for therapeutic Use.
Drimenol is a natural sesquiterpene alcohol found in plants such as Drimys species. This compound exhibits diverse pharmacological activities, including anti-inflammatory and antimicrobial properties. Drimenol has been investigated for its potential therapeutic applications in treating inflammatory disorders and infections. Research suggests that it may modulate immune responses and inhibit microbial growth. Drimenol’s unique chemical structure and biological activities make it a subject of interest in natural product chemistry and drug discovery efforts. Ongoing studies aim to elucidate its mechanisms of action and explore its potential in developing novel therapeutics.
| Catalog Number | R065125 |
| CAS Number | 468-68-8 |
| Molecular Formula | C15H26O |
| Purity | ≥95% |
| Target | Plants |
| Storage | -20°C |
| IUPAC Name | [(1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]methanol |
| InChI | InChI=1S/C15H26O/c1-11-6-7-13-14(2,3)8-5-9-15(13,4)12(11)10-16/h6,12-13,16H,5,7-10H2,1-4H3/t12-,13-,15+/m0/s1 |
| InChIKey | HMWSKUKBAWWOJL-KCQAQPDRSA-N |
| SMILES | CC1=CCC2C(CCCC2(C1CO)C)(C)C |
